C21H25ClO6 — CID 25171427
(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-pentoxyspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione (PubChem CID 25171427) has the molecular formula C21H25ClO6 and a molecular weight of 408.88 g/mol. Its IUPAC name is (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-pentoxyspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione.
| Compound Name | (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-pentoxyspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 25171427 |
| Molecular Formula | C21H25ClO6 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-pentoxyspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione |
| SMILES | CCCCCOC1=CC(=O)C[C@@H](C)[C@]12Oc1c(Cl)c(OC)cc(OC)c1C2=O |
| InChI | InChI=1S/C21H25ClO6/c1-5-6-7-8-27-16-10-13(23)9-12(2)21(16)20(24)17-14(25-3)11-15(26-4)18(22)19(17)28-21/h10-12H,5-9H2,1-4H3/t12-,21+/m1/s1 |
| InChIKey | OVSVDTPXTGNTEA-GTJPDFRWSA-N |
| XLogP | 4.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|