C20H23ClO6 — CID 23424321
3'-butoxy-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 23424321) has the molecular formula C20H23ClO6 and a molecular weight of 394.85 g/mol. Its IUPAC name is 3'-butoxy-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | 3'-butoxy-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 23424321 |
| Molecular Formula | C20H23ClO6 |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3'-butoxy-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | CCCCOC1=CC(=O)C2(Oc3c(Cl)c(OC)cc(OC)c3C2=O)C(C)C1 |
| InChI | InChI=1S/C20H23ClO6/c1-5-6-7-26-12-8-11(2)20(15(22)9-12)19(23)16-13(24-3)10-14(25-4)17(21)18(16)27-20/h9-11H,5-8H2,1-4H3 |
| InChIKey | VIQPDEWXJRMOTI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|