C18H20ClNO5S — CID 134090294
(3'E)-7-chloro-1'-ethylsulfanyl-3'-hydroxyimino-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohexene]-3-one (PubChem CID 134090294) has the molecular formula C18H20ClNO5S and a molecular weight of 397.88 g/mol. Its IUPAC name is (3'E)-7-chloro-1'-ethylsulfanyl-3'-hydroxyimino-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohexene]-3-one.
| Compound Name | (3'E)-7-chloro-1'-ethylsulfanyl-3'-hydroxyimino-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohexene]-3-one |
|---|---|
| PubChem CID | 134090294 |
| Molecular Formula | C18H20ClNO5S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (3'E)-7-chloro-1'-ethylsulfanyl-3'-hydroxyimino-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohexene]-3-one |
| SMILES | CCSC1=C/C(=N/O)CC(C)C12Oc1c(Cl)c(OC)cc(OC)c1C2=O |
| InChI | InChI=1S/C18H20ClNO5S/c1-5-26-13-7-10(20-22)6-9(2)18(13)17(21)14-11(23-3)8-12(24-4)15(19)16(14)25-18/h7-9,22H,5-6H2,1-4H3/b20-10+ |
| InChIKey | MYHFVHOUONDHAL-KEBDBYFISA-N |
| XLogP | 4.18 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|