C18H15FN2O5 — CID 25171927
methyl 3-(2-fluorophenyl)-5-[(2-nitrophenyl)methyl]-4H-1,2-oxazole-5-carboxylate (PubChem CID 25171927) has the molecular formula C18H15FN2O5 and a molecular weight of 358.32 g/mol. Its IUPAC name is methyl 3-(2-fluorophenyl)-5-[(2-nitrophenyl)methyl]-4H-1,2-oxazole-5-carboxylate.
| Compound Name | methyl 3-(2-fluorophenyl)-5-[(2-nitrophenyl)methyl]-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 25171927 |
| Molecular Formula | C18H15FN2O5 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | methyl 3-(2-fluorophenyl)-5-[(2-nitrophenyl)methyl]-4H-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1(Cc2ccccc2[N+](=O)[O-])CC(c2ccccc2F)=NO1 |
| InChI | InChI=1S/C18H15FN2O5/c1-25-17(22)18(10-12-6-2-5-9-16(12)21(23)24)11-15(20-26-18)13-7-3-4-8-14(13)19/h2-9H,10-11H2,1H3 |
| InChIKey | DWSHJRVQHPYWCU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|