C20H19FN2O7 — CID 25170460
methyl 5-[(4,5-dimethoxy-2-nitrophenyl)methyl]-3-(2-fluorophenyl)-4H-1,2-oxazole-5-carboxylate (PubChem CID 25170460) has the molecular formula C20H19FN2O7 and a molecular weight of 418.38 g/mol. Its IUPAC name is methyl 5-[(4,5-dimethoxy-2-nitrophenyl)methyl]-3-(2-fluorophenyl)-4H-1,2-oxazole-5-carboxylate.
| Compound Name | methyl 5-[(4,5-dimethoxy-2-nitrophenyl)methyl]-3-(2-fluorophenyl)-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 25170460 |
| Molecular Formula | C20H19FN2O7 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | methyl 5-[(4,5-dimethoxy-2-nitrophenyl)methyl]-3-(2-fluorophenyl)-4H-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1(Cc2cc(OC)c(OC)cc2[N+](=O)[O-])CC(c2ccccc2F)=NO1 |
| InChI | InChI=1S/C20H19FN2O7/c1-27-17-8-12(16(23(25)26)9-18(17)28-2)10-20(19(24)29-3)11-15(22-30-20)13-6-4-5-7-14(13)21/h4-9H,10-11H2,1-3H3 |
| InChIKey | LSZQRVWOUQXZFK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 109.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|