C18H21ClN2O2S — CID 25173567
N-(2-tert-butyl-4-prop-2-enyl-1,2-thiazol-5-ylidene)-5-chloro-2-methoxybenzamide (PubChem CID 25173567) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is N-(2-tert-butyl-4-prop-2-enyl-1,2-thiazol-5-ylidene)-5-chloro-2-methoxybenzamide.
| Compound Name | N-(2-tert-butyl-4-prop-2-enyl-1,2-thiazol-5-ylidene)-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 25173567 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-(2-tert-butyl-4-prop-2-enyl-1,2-thiazol-5-ylidene)-5-chloro-2-methoxybenzamide |
| SMILES | C=CCc1cn(C(C)(C)C)s/c1=N/C(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C18H21ClN2O2S/c1-6-7-12-11-21(18(2,3)4)24-17(12)20-16(22)14-10-13(19)8-9-15(14)23-5/h6,8-11H,1,7H2,2-5H3/b20-17+ |
| InChIKey | AOOTZWVSBHFENY-LVZFUZTISA-N |
| XLogP | 4.44 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|