C15H22N2O5S-2 — CID 25173688
cis-(1R,2S)-2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide sulfate (PubChem CID 25173688) has the molecular formula C15H22N2O5S-2 and a molecular weight of 342.42 g/mol. Its IUPAC name is cis-(1R,2S)-2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide sulfate.
| Compound Name | cis-(1R,2S)-2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide sulfate |
|---|---|
| PubChem CID | 25173688 |
| Molecular Formula | C15H22N2O5S-2 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | cis-(1R,2S)-2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide sulfate |
| SMILES | CCN(CC)C(=O)[C@]1(c2ccccc2)C[C@@H]1CN.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C15H22N2O.H2O4S/c1-3-17(4-2)14(18)15(10-13(15)11-16)12-8-6-5-7-9-12;1-5(2,3)4/h5-9,13H,3-4,10-11,16H2,1-2H3;(H2,1,2,3,4)/p-2/t13-,15+;/m1./s1 |
| InChIKey | NZXRNJAIEARFGD-PBCQUBLHSA-L |
| XLogP | 0.43 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|