C15H22N2O — CID 129009853
cis-(1S,2R)-2-(aminomethyl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide (PubChem CID 129009853) has the molecular formula C15H22N2O and a molecular weight of 256.42 g/mol. Its IUPAC name is cis-(1S,2R)-2-(aminomethyl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-(aminomethyl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 129009853 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | cis-(1S,2R)-2-(aminomethyl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C(=O)[C@@]1(c2ccccc2)C[C@H]1CN)C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C15H22N2O/c1-3-17(4-2)14(18)15(10-13(15)11-16)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11,16H2,1-2H3/t13-,15+/m0/s1/i1D3,2D3,3D2,4D2 |
| InChIKey | GJJFMKBJSRMPLA-XDGXGAIGSA-N |
| XLogP | 1.77 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |