C23H24N2O3 — CID 71316170
trans-(1S,2S)-2-[(1,3-dioxoisoindol-2-yl)methyl]-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide (PubChem CID 71316170) has the molecular formula C23H24N2O3 and a molecular weight of 386.52 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(1,3-dioxoisoindol-2-yl)methyl]-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-[(1,3-dioxoisoindol-2-yl)methyl]-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71316170 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | trans-(1S,2S)-2-[(1,3-dioxoisoindol-2-yl)methyl]-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C(=O)[C@@]1(c2ccccc2)C[C@@H]1CN1C(=O)c2ccccc2C1=O)C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C23H24N2O3/c1-3-24(4-2)22(28)23(16-10-6-5-7-11-16)14-17(23)15-25-20(26)18-12-8-9-13-19(18)21(25)27/h5-13,17H,3-4,14-15H2,1-2H3/t17-,23-/m1/s1/i1D3,2D3,3D2,4D2 |
| InChIKey | JOTWZGIFEGRKFM-IUZKBZNSSA-N |
| XLogP | 3.11 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|