C24H32N2O4 — CID 155438388
tert-butyl N-[2-[(1,3-dioxoisoindol-2-yl)methyl]spiro[3.5]nonan-7-yl]-N-methylcarbamate (PubChem CID 155438388) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is tert-butyl N-[2-[(1,3-dioxoisoindol-2-yl)methyl]spiro[3.5]nonan-7-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[(1,3-dioxoisoindol-2-yl)methyl]spiro[3.5]nonan-7-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 155438388 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | tert-butyl N-[2-[(1,3-dioxoisoindol-2-yl)methyl]spiro[3.5]nonan-7-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCC2(CC1)CC(CN1C(=O)c3ccccc3C1=O)C2 |
| InChI | InChI=1S/C24H32N2O4/c1-23(2,3)30-22(29)25(4)17-9-11-24(12-10-17)13-16(14-24)15-26-20(27)18-7-5-6-8-19(18)21(26)28/h5-8,16-17H,9-15H2,1-4H3 |
| InChIKey | MTLZSDDMEQKFLN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|