C28H36N4O6 — CID 155437854
tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]spiro[3.5]nonan-7-yl]-N-methylcarbamate (PubChem CID 155437854) has the molecular formula C28H36N4O6 and a molecular weight of 524.62 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]spiro[3.5]nonan-7-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]spiro[3.5]nonan-7-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 155437854 |
| Molecular Formula | C28H36N4O6 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]spiro[3.5]nonan-7-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCC2(CC1)CC(Nc1ccc3c(c1)C(=O)N(C1CCC(=O)NC1=O)C3=O)C2 |
| InChI | InChI=1S/C28H36N4O6/c1-27(2,3)38-26(37)31(4)18-9-11-28(12-10-18)14-17(15-28)29-16-5-6-19-20(13-16)25(36)32(24(19)35)21-7-8-22(33)30-23(21)34/h5-6,13,17-18,21,29H,7-12,14-15H2,1-4H3,(H,30,33,34) |
| InChIKey | AZIWTRSXCNCLSK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|