C29H38F3N5O8 — CID 25177556
[2-cyano-4-[6-[3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]hexylcarbamoyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate (PubChem CID 25177556) has the molecular formula C29H38F3N5O8 and a molecular weight of 641.64 g/mol. Its IUPAC name is [2-cyano-4-[6-[3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]hexylcarbamoyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | [2-cyano-4-[6-[3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]hexylcarbamoyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 25177556 |
| Molecular Formula | C29H38F3N5O8 |
| Molecular Weight | 641.64 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | [2-cyano-4-[6-[3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]hexylcarbamoyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)n(CCCCCCNC(=O)c2ccc([N+](C)(C)C)c(C#N)c2)c1=O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H37N5O6.C2HF3O2/c1-18-16-31(24-14-22(34)23(17-33)38-24)27(37)30(26(18)36)12-8-6-5-7-11-29-25(35)19-9-10-21(32(2,3)4)20(13-19)15-28;3-2(4,5)1(6)7/h9-10,13,16,22-24,33-34H,5-8,11-12,14,17H2,1-4H3;(H,6,7)/t22-,23+,24+;/m0./s1 |
| InChIKey | HLBUHUBAWFZCSZ-BAUONJEJSA-N |
| XLogP | 0.32 |
| TPSA | 186.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.64 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|