C20H24FN3O5 — CID 71088843
4-fluoro-N-[3-[3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]propyl]benzamide (PubChem CID 71088843) has the molecular formula C20H24FN3O5 and a molecular weight of 405.43 g/mol. Its IUPAC name is 4-fluoro-N-[3-[3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]propyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 71088843 |
| Molecular Formula | C20H24FN3O5 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-fluoro-N-[3-[3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]propyl]benzamide |
| SMILES | Cc1cn([C@H]2CC[C@@H](CO)O2)c(=O)n(CCCNC(=O)c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C20H24FN3O5/c1-13-11-24(17-8-7-16(12-25)29-17)20(28)23(19(13)27)10-2-9-22-18(26)14-3-5-15(21)6-4-14/h3-6,11,16-17,25H,2,7-10,12H2,1H3,(H,22,26)/t16-,17+/m0/s1 |
| InChIKey | BSPYVWBPMVHRTD-DLBZAZTESA-N |
| XLogP | 0.95 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|