C23H26FN5O6 — CID 143638699
3-cyano-4-fluoro-N-[5-[[3-[5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]amino]-5-oxopentyl]benzamide (PubChem CID 143638699) has the molecular formula C23H26FN5O6 and a molecular weight of 487.49 g/mol. Its IUPAC name is 3-cyano-4-fluoro-N-[5-[[3-[5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]amino]-5-oxopentyl]benzamide.
| Compound Name | 3-cyano-4-fluoro-N-[5-[[3-[5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]amino]-5-oxopentyl]benzamide |
|---|---|
| PubChem CID | 143638699 |
| Molecular Formula | C23H26FN5O6 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 3-cyano-4-fluoro-N-[5-[[3-[5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]amino]-5-oxopentyl]benzamide |
| SMILES | Cc1cn(C2CCC(CO)O2)c(=O)n(NC(=O)CCCCNC(=O)c2ccc(F)c(C#N)c2)c1=O |
| InChI | InChI=1S/C23H26FN5O6/c1-14-12-28(20-8-6-17(13-30)35-20)23(34)29(22(14)33)27-19(31)4-2-3-9-26-21(32)15-5-7-18(24)16(10-15)11-25/h5,7,10,12,17,20,30H,2-4,6,8-9,13H2,1H3,(H,26,32)(H,27,31) |
| InChIKey | DUFCGJMUMOXHCU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 155.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|