C23H31FN4O5 — CID 145463507
3-cyano-4-fluoro-N-[6-[hydroxy-[(Z)-3-[[(5S)-5-(hydroxymethyl)oxolan-2-yl]amino]-2-methylprop-2-enoyl]amino]hexyl]benzamide (PubChem CID 145463507) has the molecular formula C23H31FN4O5 and a molecular weight of 462.52 g/mol. Its IUPAC name is 3-cyano-4-fluoro-N-[6-[hydroxy-[(Z)-3-[[(5S)-5-(hydroxymethyl)oxolan-2-yl]amino]-2-methylprop-2-enoyl]amino]hexyl]benzamide.
| Compound Name | 3-cyano-4-fluoro-N-[6-[hydroxy-[(Z)-3-[[(5S)-5-(hydroxymethyl)oxolan-2-yl]amino]-2-methylprop-2-enoyl]amino]hexyl]benzamide |
|---|---|
| PubChem CID | 145463507 |
| Molecular Formula | C23H31FN4O5 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 3-cyano-4-fluoro-N-[6-[hydroxy-[(Z)-3-[[(5S)-5-(hydroxymethyl)oxolan-2-yl]amino]-2-methylprop-2-enoyl]amino]hexyl]benzamide |
| SMILES | C/C(=C/NC1CC[C@@H](CO)O1)C(=O)N(O)CCCCCCNC(=O)c1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C23H31FN4O5/c1-16(14-27-21-9-7-19(15-29)33-21)23(31)28(32)11-5-3-2-4-10-26-22(30)17-6-8-20(24)18(12-17)13-25/h6,8,12,14,19,21,27,29,32H,2-5,7,9-11,15H2,1H3,(H,26,30)/b16-14-/t19-,21?/m0/s1 |
| InChIKey | KRLNFRDLNBWJIA-MQYNSHASSA-N |
| XLogP | 2.20 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|