C42H48N8+2 — CID 25178744
2-indolo[3,2-b]quinoxalin-6-ylethyl-[6-[2-indolo[3,2-b]quinoxalin-6-ylethyl(dimethyl)azaniumyl]hexyl]-dimethylazanium (PubChem CID 25178744) has the molecular formula C42H48N8+2 and a molecular weight of 664.90 g/mol. Its IUPAC name is 2-indolo[3,2-b]quinoxalin-6-ylethyl-[6-[2-indolo[3,2-b]quinoxalin-6-ylethyl(dimethyl)azaniumyl]hexyl]-dimethylazanium.
| Compound Name | 2-indolo[3,2-b]quinoxalin-6-ylethyl-[6-[2-indolo[3,2-b]quinoxalin-6-ylethyl(dimethyl)azaniumyl]hexyl]-dimethylazanium |
|---|---|
| PubChem CID | 25178744 |
| Molecular Formula | C42H48N8+2 |
| Molecular Weight | 664.90 g/mol |
| Exact Mass | 664.40 |
| IUPAC Name | 2-indolo[3,2-b]quinoxalin-6-ylethyl-[6-[2-indolo[3,2-b]quinoxalin-6-ylethyl(dimethyl)azaniumyl]hexyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCCCC[N+](C)(C)CCn1c2ccccc2c2nc3ccccc3nc21)CCn1c2ccccc2c2nc3ccccc3nc21 |
| InChI | InChI=1S/C42H48N8/c1-49(2,29-25-47-37-23-13-7-17-31(37)39-41(47)45-35-21-11-9-19-33(35)43-39)27-15-5-6-16-28-50(3,4)30-26-48-38-24-14-8-18-32(38)40-42(48)46-36-22-12-10-20-34(36)44-40/h7-14,17-24H,5-6,15-16,25-30H2,1-4H3/q+2 |
| InChIKey | VBOOTTOFKQKSDE-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.90 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|