C17H21NO3 — CID 25178797
(3R,6R)-6-(methoxymethyl)-3,6-dimethyl-5-phenyl-3-prop-2-enyl-1,4-oxazin-2-one (PubChem CID 25178797) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (3R,6R)-6-(methoxymethyl)-3,6-dimethyl-5-phenyl-3-prop-2-enyl-1,4-oxazin-2-one.
| Compound Name | (3R,6R)-6-(methoxymethyl)-3,6-dimethyl-5-phenyl-3-prop-2-enyl-1,4-oxazin-2-one |
|---|---|
| PubChem CID | 25178797 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (3R,6R)-6-(methoxymethyl)-3,6-dimethyl-5-phenyl-3-prop-2-enyl-1,4-oxazin-2-one |
| SMILES | C=CC[C@@]1(C)N=C(c2ccccc2)[C@](C)(COC)OC1=O |
| InChI | InChI=1S/C17H21NO3/c1-5-11-16(2)15(19)21-17(3,12-20-4)14(18-16)13-9-7-6-8-10-13/h5-10H,1,11-12H2,2-4H3/t16-,17+/m1/s1 |
| InChIKey | ZTHJUGCWOUQHDJ-SJORKVTESA-N |
| XLogP | 2.77 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|