C12H15BrN2O2 — CID 25179457
methyl (E)-2-(2-bromophenyl)-3-(2,2-dimethylhydrazinyl)prop-2-enoate (PubChem CID 25179457) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is methyl (E)-2-(2-bromophenyl)-3-(2,2-dimethylhydrazinyl)prop-2-enoate.
| Compound Name | methyl (E)-2-(2-bromophenyl)-3-(2,2-dimethylhydrazinyl)prop-2-enoate |
|---|---|
| PubChem CID | 25179457 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | methyl (E)-2-(2-bromophenyl)-3-(2,2-dimethylhydrazinyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C/NN(C)C)c1ccccc1Br |
| InChI | InChI=1S/C12H15BrN2O2/c1-15(2)14-8-10(12(16)17-3)9-6-4-5-7-11(9)13/h4-8,14H,1-3H3/b10-8+ |
| InChIKey | YOCPWGUFHDRPLO-CSKARUKUSA-N |
| XLogP | 2.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|