C20H37N3O6 — CID 25180624
ditert-butyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]diazinane-1,2-dicarboxylate (PubChem CID 25180624) has the molecular formula C20H37N3O6 and a molecular weight of 415.53 g/mol. Its IUPAC name is ditert-butyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]diazinane-1,2-dicarboxylate.
| Compound Name | ditert-butyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]diazinane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 25180624 |
| Molecular Formula | C20H37N3O6 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | ditert-butyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]diazinane-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCN(C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37N3O6/c1-18(2,3)27-15(24)21-13-14-11-10-12-22(16(25)28-19(4,5)6)23(14)17(26)29-20(7,8)9/h14H,10-13H2,1-9H3,(H,21,24) |
| InChIKey | PEWNKAAESTYVMK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|