C15H26N2O5 — CID 168880403
ditert-butyl (3S)-3-formyldiazinane-1,2-dicarboxylate (PubChem CID 168880403) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is ditert-butyl (3S)-3-formyldiazinane-1,2-dicarboxylate.
| Compound Name | ditert-butyl (3S)-3-formyldiazinane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 168880403 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | ditert-butyl (3S)-3-formyldiazinane-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N2O5/c1-14(2,3)21-12(19)16-9-7-8-11(10-18)17(16)13(20)22-15(4,5)6/h10-11H,7-9H2,1-6H3/t11-/m0/s1 |
| InChIKey | GYMMDMXCPKEWHL-NSHDSACASA-N |
| XLogP | 2.74 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|