C11H20N2O4 — CID 87788589
tert-butyl 2-[(2S)-2-formylpyrrolidin-1-yl]oxy-N-hydroxyethanimidate (PubChem CID 87788589) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-2-formylpyrrolidin-1-yl]oxy-N-hydroxyethanimidate.
| Compound Name | tert-butyl 2-[(2S)-2-formylpyrrolidin-1-yl]oxy-N-hydroxyethanimidate |
|---|---|
| PubChem CID | 87788589 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | tert-butyl 2-[(2S)-2-formylpyrrolidin-1-yl]oxy-N-hydroxyethanimidate |
| SMILES | CC(C)(C)OC(CON1CCC[C@H]1C=O)=NO |
| InChI | InChI=1S/C11H20N2O4/c1-11(2,3)17-10(12-15)8-16-13-6-4-5-9(13)7-14/h7,9,15H,4-6,8H2,1-3H3/t9-/m0/s1 |
| InChIKey | SUQNBXHPCBJNBU-VIFPVBQESA-N |
| XLogP | 1.18 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|