C18H24ClN3O3S — CID 25181481
N-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-chlorophenyl)sulfonyl-2-methylpropanamide (PubChem CID 25181481) has the molecular formula C18H24ClN3O3S and a molecular weight of 397.93 g/mol. Its IUPAC name is N-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-chlorophenyl)sulfonyl-2-methylpropanamide.
| Compound Name | N-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-chlorophenyl)sulfonyl-2-methylpropanamide |
|---|---|
| PubChem CID | 25181481 |
| Molecular Formula | C18H24ClN3O3S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-chlorophenyl)sulfonyl-2-methylpropanamide |
| SMILES | Cn1nc(C(C)(C)C)cc1NC(=O)C(C)(C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClN3O3S/c1-17(2,3)14-11-15(22(6)21-14)20-16(23)18(4,5)26(24,25)13-9-7-12(19)8-10-13/h7-11H,1-6H3,(H,20,23) |
| InChIKey | YTVVUEHBECILFK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |