C15H18FN3O3S — CID 42109669
N-(2,5-dimethylpyrazol-3-yl)-4-(4-fluorophenyl)sulfonylbutanamide (PubChem CID 42109669) has the molecular formula C15H18FN3O3S and a molecular weight of 339.39 g/mol. Its IUPAC name is N-(2,5-dimethylpyrazol-3-yl)-4-(4-fluorophenyl)sulfonylbutanamide.
| Compound Name | N-(2,5-dimethylpyrazol-3-yl)-4-(4-fluorophenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 42109669 |
| Molecular Formula | C15H18FN3O3S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-(2,5-dimethylpyrazol-3-yl)-4-(4-fluorophenyl)sulfonylbutanamide |
| SMILES | Cc1cc(NC(=O)CCCS(=O)(=O)c2ccc(F)cc2)n(C)n1 |
| InChI | InChI=1S/C15H18FN3O3S/c1-11-10-14(19(2)18-11)17-15(20)4-3-9-23(21,22)13-7-5-12(16)6-8-13/h5-8,10H,3-4,9H2,1-2H3,(H,17,20) |
| InChIKey | RYWDYEDVYAALLY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |