About benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate
benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate (PubChem CID 25185228) has the molecular formula C21H23N3O2
and a molecular weight of 349.43 g/mol. Its IUPAC name is benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate.
Molecular Properties
| Compound Name | benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate |
| PubChem CID | 25185228 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccccc1)/C(N)=N/C(C=C)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O2/c1-3-15-24(21(25)26-16-17-11-7-5-8-12-17)20(22)23-19(4-2)18-13-9-6-10-14-18/h3-14,19H,1-2,15-16H2,(H2,22,23) |
| InChIKey | PLORIMVZAMLGGT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate?
The IUPAC name of benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate (CID 25185228) is benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate.
What is the SMILES notation for benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate?
The canonical SMILES for benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate is C=CCN(C(=O)OCc1ccccc1)/C(N)=N/C(C=C)c1ccccc1.
What is the InChIKey of benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate?
The InChIKey is PLORIMVZAMLGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2/c1-3-15-24(21(25)26-16-17-11-7-5-8-12-17)20(22)23-19(4-2)18-13-9-6-10-14-18/h3-14,19H,1-2,15-16H2,(H2,22,23).
What are the key properties of benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate?
benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate has a molecular weight of 349.43 g/mol, XLogP of 4.05, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[N'-(1-phenylprop-2-enyl)carbamimidoyl]-N-prop-2-enylcarbamate is sourced from PubChem (CID 25185228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).