C28H37N3O7 — CID 25185853
2-[[1-cyclohexyl-2-(cyclohexylamino)-2-oxoethyl]-[2-(5,6-dimethoxy-1H-indol-3-yl)-2-oxoacetyl]amino]acetic acid (PubChem CID 25185853) has the molecular formula C28H37N3O7 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-[[1-cyclohexyl-2-(cyclohexylamino)-2-oxoethyl]-[2-(5,6-dimethoxy-1H-indol-3-yl)-2-oxoacetyl]amino]acetic acid.
| Compound Name | 2-[[1-cyclohexyl-2-(cyclohexylamino)-2-oxoethyl]-[2-(5,6-dimethoxy-1H-indol-3-yl)-2-oxoacetyl]amino]acetic acid |
|---|---|
| PubChem CID | 25185853 |
| Molecular Formula | C28H37N3O7 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 2-[[1-cyclohexyl-2-(cyclohexylamino)-2-oxoethyl]-[2-(5,6-dimethoxy-1H-indol-3-yl)-2-oxoacetyl]amino]acetic acid |
| SMILES | COc1cc2[nH]cc(C(=O)C(=O)N(CC(=O)O)C(C(=O)NC3CCCCC3)C3CCCCC3)c2cc1OC |
| InChI | InChI=1S/C28H37N3O7/c1-37-22-13-19-20(15-29-21(19)14-23(22)38-2)26(34)28(36)31(16-24(32)33)25(17-9-5-3-6-10-17)27(35)30-18-11-7-4-8-12-18/h13-15,17-18,25,29H,3-12,16H2,1-2H3,(H,30,35)(H,32,33) |
| InChIKey | GQMWLVQZBLBYPO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 138.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|