C34H40N4O3 — CID 3190827
N-cyclohexyl-2-[4-(dimethylamino)phenyl]-2-[[2-(1H-indol-3-yl)acetyl]-[(2-methoxyphenyl)methyl]amino]acetamide (PubChem CID 3190827) has the molecular formula C34H40N4O3 and a molecular weight of 552.72 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-(dimethylamino)phenyl]-2-[[2-(1H-indol-3-yl)acetyl]-[(2-methoxyphenyl)methyl]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[4-(dimethylamino)phenyl]-2-[[2-(1H-indol-3-yl)acetyl]-[(2-methoxyphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 3190827 |
| Molecular Formula | C34H40N4O3 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | N-cyclohexyl-2-[4-(dimethylamino)phenyl]-2-[[2-(1H-indol-3-yl)acetyl]-[(2-methoxyphenyl)methyl]amino]acetamide |
| SMILES | COc1ccccc1CN(C(=O)Cc1c[nH]c2ccccc12)C(C(=O)NC1CCCCC1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C34H40N4O3/c1-37(2)28-19-17-24(18-20-28)33(34(40)36-27-12-5-4-6-13-27)38(23-25-11-7-10-16-31(25)41-3)32(39)21-26-22-35-30-15-9-8-14-29(26)30/h7-11,14-20,22,27,33,35H,4-6,12-13,21,23H2,1-3H3,(H,36,40) |
| InChIKey | SLCOMVYUXPKNBW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|