C31H36N4O2S — CID 25309081
(2R)-N-cyclohexyl-2-[4-(dimethylamino)phenyl]-2-[[2-(1H-indol-3-yl)acetyl]-(thiophen-2-ylmethyl)amino]acetamide (PubChem CID 25309081) has the molecular formula C31H36N4O2S and a molecular weight of 528.72 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[4-(dimethylamino)phenyl]-2-[[2-(1H-indol-3-yl)acetyl]-(thiophen-2-ylmethyl)amino]acetamide.
| Compound Name | (2R)-N-cyclohexyl-2-[4-(dimethylamino)phenyl]-2-[[2-(1H-indol-3-yl)acetyl]-(thiophen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 25309081 |
| Molecular Formula | C31H36N4O2S |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[4-(dimethylamino)phenyl]-2-[[2-(1H-indol-3-yl)acetyl]-(thiophen-2-ylmethyl)amino]acetamide |
| SMILES | CN(C)c1ccc([C@H](C(=O)NC2CCCCC2)N(Cc2cccs2)C(=O)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C31H36N4O2S/c1-34(2)25-16-14-22(15-17-25)30(31(37)33-24-9-4-3-5-10-24)35(21-26-11-8-18-38-26)29(36)19-23-20-32-28-13-7-6-12-27(23)28/h6-8,11-18,20,24,30,32H,3-5,9-10,19,21H2,1-2H3,(H,33,37)/t30-/m1/s1 |
| InChIKey | PUNICJYQZWKMMI-SSEXGKCCSA-N |
| XLogP | 6.06 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|