C18H14N2O5S2 — CID 25186387
[2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] benzoate (PubChem CID 25186387) has the molecular formula C18H14N2O5S2 and a molecular weight of 402.45 g/mol. Its IUPAC name is [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] benzoate.
| Compound Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] benzoate |
|---|---|
| PubChem CID | 25186387 |
| Molecular Formula | C18H14N2O5S2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] benzoate |
| SMILES | CS(=O)(=O)c1cnc(NC(=O)c2ccccc2OC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C18H14N2O5S2/c1-27(23,24)15-11-19-18(26-15)20-16(21)13-9-5-6-10-14(13)25-17(22)12-7-3-2-4-8-12/h2-11H,1H3,(H,19,20,21) |
| InChIKey | JMAAXZBVFYJSFY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|