C29H36O2S — CID 25188229
benzyl 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoate (PubChem CID 25188229) has the molecular formula C29H36O2S and a molecular weight of 448.70 g/mol. Its IUPAC name is benzyl 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoate.
| Compound Name | benzyl 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 25188229 |
| Molecular Formula | C29H36O2S |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | benzyl 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoate |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CSC1=CC=CC=C1C(=O)OCC2=CC=CC=C2)/C)/C)C |
| InChI | InChI=1S/C29H36O2S/c1-23(2)12-10-13-24(3)14-11-15-25(4)20-21-32-28-19-9-8-18-27(28)29(30)31-22-26-16-6-5-7-17-26/h5-9,12,14,16-20H,10-11,13,15,21-22H2,1-4H3/b24-14+,25-20+ |
| InChIKey | QFZPEVVEVPCUQT-JYPYDPOKSA-N |
| XLogP | 9.00 |
| TPSA | 51.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | 636 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|