C14H12F3NO4S — CID 25189321
(5Z)-5-[[2-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 25189321) has the molecular formula C14H12F3NO4S and a molecular weight of 347.31 g/mol. Its IUPAC name is (5Z)-5-[[2-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 25189321 |
| Molecular Formula | C14H12F3NO4S |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | (5Z)-5-[[2-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COCCOc1c(/C=C2\SC(=O)NC2=O)cccc1C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO4S/c1-21-5-6-22-11-8(3-2-4-9(11)14(15,16)17)7-10-12(19)18-13(20)23-10/h2-4,7H,5-6H2,1H3,(H,18,19,20)/b10-7- |
| InChIKey | COWYLFMXYWAALI-YFHOEESVSA-N |
| XLogP | 3.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|