C21H21BFNO6 — CID 25189387
dimethyl (4S,5S)-2-[2-[1-(4-fluorophenyl)ethyliminomethyl]phenyl]-1,3,2-dioxaborolane-4,5-dicarboxylate (PubChem CID 25189387) has the molecular formula C21H21BFNO6 and a molecular weight of 413.21 g/mol. Its IUPAC name is dimethyl (4S,5S)-2-[2-[1-(4-fluorophenyl)ethyliminomethyl]phenyl]-1,3,2-dioxaborolane-4,5-dicarboxylate.
| Compound Name | dimethyl (4S,5S)-2-[2-[1-(4-fluorophenyl)ethyliminomethyl]phenyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 25189387 |
| Molecular Formula | C21H21BFNO6 |
| Molecular Weight | 413.21 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | dimethyl (4S,5S)-2-[2-[1-(4-fluorophenyl)ethyliminomethyl]phenyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1OB(c2ccccc2/C=N/C(C)c2ccc(F)cc2)O[C@@H]1C(=O)OC |
| InChI | InChI=1S/C21H21BFNO6/c1-13(14-8-10-16(23)11-9-14)24-12-15-6-4-5-7-17(15)22-29-18(20(25)27-2)19(30-22)21(26)28-3/h4-13,18-19H,1-3H3/b24-12+/t13?,18-,19-/m0/s1 |
| InChIKey | PWKWFSHGZAKJPS-JGYSACJPSA-N |
| XLogP | 1.83 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|