C25H23BFNO4 — CID 25185525
methyl (4S,5R)-2-[4-fluoro-2-(1-phenylethyliminomethyl)phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate (PubChem CID 25185525) has the molecular formula C25H23BFNO4 and a molecular weight of 431.27 g/mol. Its IUPAC name is methyl (4S,5R)-2-[4-fluoro-2-(1-phenylethyliminomethyl)phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate.
| Compound Name | methyl (4S,5R)-2-[4-fluoro-2-(1-phenylethyliminomethyl)phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate |
|---|---|
| PubChem CID | 25185525 |
| Molecular Formula | C25H23BFNO4 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | methyl (4S,5R)-2-[4-fluoro-2-(1-phenylethyliminomethyl)phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate |
| SMILES | COC(=O)[C@H]1OB(c2ccc(F)cc2/C=N/C(C)c2ccccc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H23BFNO4/c1-17(18-9-5-3-6-10-18)28-16-20-15-21(27)13-14-22(20)26-31-23(19-11-7-4-8-12-19)24(32-26)25(29)30-2/h3-17,23-24H,1-2H3/b28-16+/t17?,23-,24+/m1/s1 |
| InChIKey | PZWOCILXMHPGFH-GCGHTUROSA-N |
| XLogP | 4.03 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|