C27H38BNO5Si — CID 102279587
methyl (4S,5R)-2-[2-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]iminomethyl]phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate (PubChem CID 102279587) has the molecular formula C27H38BNO5Si and a molecular weight of 495.50 g/mol. Its IUPAC name is methyl (4S,5R)-2-[2-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]iminomethyl]phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate.
| Compound Name | methyl (4S,5R)-2-[2-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]iminomethyl]phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate |
|---|---|
| PubChem CID | 102279587 |
| Molecular Formula | C27H38BNO5Si |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | methyl (4S,5R)-2-[2-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]iminomethyl]phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate |
| SMILES | CC[C@H](CO[Si](C)(C)C(C)(C)C)/N=C/c1ccccc1B1O[C@H](C(=O)OC)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C27H38BNO5Si/c1-8-22(19-32-35(6,7)27(2,3)4)29-18-21-16-12-13-17-23(21)28-33-24(20-14-10-9-11-15-20)25(34-28)26(30)31-5/h9-18,22,24-25H,8,19H2,1-7H3/b29-18+/t22-,24-,25+/m1/s1 |
| InChIKey | UMKPVQDMMMGFGJ-JNPLQQAGSA-N |
| XLogP | 4.93 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|