C31H38BNO5Si — CID 102279588
methyl (4R,5S)-2-[2-[[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]iminomethyl]phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate (PubChem CID 102279588) has the molecular formula C31H38BNO5Si and a molecular weight of 543.55 g/mol. Its IUPAC name is methyl (4R,5S)-2-[2-[[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]iminomethyl]phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate.
| Compound Name | methyl (4R,5S)-2-[2-[[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]iminomethyl]phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate |
|---|---|
| PubChem CID | 102279588 |
| Molecular Formula | C31H38BNO5Si |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | methyl (4R,5S)-2-[2-[[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]iminomethyl]phenyl]-5-phenyl-1,3,2-dioxaborolane-4-carboxylate |
| SMILES | COC(=O)[C@@H]1OB(c2ccccc2/C=N/[C@H](CO[Si](C)(C)C(C)(C)C)c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H38BNO5Si/c1-31(2,3)39(5,6)36-22-27(23-15-9-7-10-16-23)33-21-25-19-13-14-20-26(25)32-37-28(24-17-11-8-12-18-24)29(38-32)30(34)35-4/h7-21,27-29H,22H2,1-6H3/b33-21+/t27-,28+,29-/m1/s1 |
| InChIKey | JGBLATVFOHRJKY-XTYBCTHKSA-N |
| XLogP | 5.89 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|