C23H20BNO3 — CID 56957867
(5R)-5-phenyl-2-[2-[[(1R)-1-phenylethyl]iminomethyl]phenyl]-1,3,2-dioxaborolan-4-one (PubChem CID 56957867) has the molecular formula C23H20BNO3 and a molecular weight of 369.23 g/mol. Its IUPAC name is (5R)-5-phenyl-2-[2-[[(1R)-1-phenylethyl]iminomethyl]phenyl]-1,3,2-dioxaborolan-4-one.
| Compound Name | (5R)-5-phenyl-2-[2-[[(1R)-1-phenylethyl]iminomethyl]phenyl]-1,3,2-dioxaborolan-4-one |
|---|---|
| PubChem CID | 56957867 |
| Molecular Formula | C23H20BNO3 |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (5R)-5-phenyl-2-[2-[[(1R)-1-phenylethyl]iminomethyl]phenyl]-1,3,2-dioxaborolan-4-one |
| SMILES | C[C@@H](/N=C/c1ccccc1B1OC(=O)[C@@H](c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C23H20BNO3/c1-17(18-10-4-2-5-11-18)25-16-20-14-8-9-15-21(20)24-27-22(23(26)28-24)19-12-6-3-7-13-19/h2-17,22H,1H3/b25-16+/t17-,22-/m1/s1 |
| InChIKey | RNABUFSIAKUYCQ-GYBNKOMZSA-N |
| XLogP | 3.88 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|