C24H24BNO2 — CID 102185871
1-[2-[(4R)-4-methyl-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine (PubChem CID 102185871) has the molecular formula C24H24BNO2 and a molecular weight of 369.27 g/mol. Its IUPAC name is 1-[2-[(4R)-4-methyl-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine.
| Compound Name | 1-[2-[(4R)-4-methyl-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine |
|---|---|
| PubChem CID | 102185871 |
| Molecular Formula | C24H24BNO2 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-[2-[(4R)-4-methyl-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine |
| SMILES | C[C@H](/N=C/c1ccccc1B1OC[C@@](C)(c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C24H24BNO2/c1-19(20-11-5-3-6-12-20)26-17-21-13-9-10-16-23(21)25-27-18-24(2,28-25)22-14-7-4-8-15-22/h3-17,19H,18H2,1-2H3/b26-17+/t19-,24-/m0/s1 |
| InChIKey | JLYJBYNRQCAIGH-SGYDNYDDSA-N |
| XLogP | 4.52 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|