C27H27ClN4O — CID 25190235
N-[[1-(4-chlorophenyl)cyclohexyl]methyl]-4-methyl-1-pyrimidin-2-ylindole-3-carboxamide (PubChem CID 25190235) has the molecular formula C27H27ClN4O and a molecular weight of 458.99 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)cyclohexyl]methyl]-4-methyl-1-pyrimidin-2-ylindole-3-carboxamide.
| Compound Name | N-[[1-(4-chlorophenyl)cyclohexyl]methyl]-4-methyl-1-pyrimidin-2-ylindole-3-carboxamide |
|---|---|
| PubChem CID | 25190235 |
| Molecular Formula | C27H27ClN4O |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N-[[1-(4-chlorophenyl)cyclohexyl]methyl]-4-methyl-1-pyrimidin-2-ylindole-3-carboxamide |
| SMILES | Cc1cccc2c1c(C(=O)NCC1(c3ccc(Cl)cc3)CCCCC1)cn2-c1ncccn1 |
| InChI | InChI=1S/C27H27ClN4O/c1-19-7-5-8-23-24(19)22(17-32(23)26-29-15-6-16-30-26)25(33)31-18-27(13-3-2-4-14-27)20-9-11-21(28)12-10-20/h5-12,15-17H,2-4,13-14,18H2,1H3,(H,31,33) |
| InChIKey | KYMISPJLBMCXEX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |