C23H24F2N4O4 — CID 25190502
(3R,4R)-4-[[4-[[2-(1,1-difluoroethyl)benzimidazol-1-yl]methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide (PubChem CID 25190502) has the molecular formula C23H24F2N4O4 and a molecular weight of 458.47 g/mol. Its IUPAC name is (3R,4R)-4-[[4-[[2-(1,1-difluoroethyl)benzimidazol-1-yl]methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide.
| Compound Name | (3R,4R)-4-[[4-[[2-(1,1-difluoroethyl)benzimidazol-1-yl]methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide |
|---|---|
| PubChem CID | 25190502 |
| Molecular Formula | C23H24F2N4O4 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (3R,4R)-4-[[4-[[2-(1,1-difluoroethyl)benzimidazol-1-yl]methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide |
| SMILES | CC(F)(F)c1nc2ccccc2n1Cc1ccc(C(=O)N[C@@H]2CCOC[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C23H24F2N4O4/c1-23(24,25)22-27-18-4-2-3-5-19(18)29(22)12-14-6-8-15(9-7-14)20(30)26-17-10-11-33-13-16(17)21(31)28-32/h2-9,16-17,32H,10-13H2,1H3,(H,26,30)(H,28,31)/t16-,17+/m0/s1 |
| InChIKey | QCELJPBZUJYPIW-DLBZAZTESA-N |
| XLogP | 2.84 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|