C16H10FNO — CID 25190932
9-fluoro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one (PubChem CID 25190932) has the molecular formula C16H10FNO and a molecular weight of 251.26 g/mol. Its IUPAC name is 9-fluoro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one.
| Compound Name | 9-fluoro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 25190932 |
| Molecular Formula | C16H10FNO |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 9-fluoro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
| SMILES | O=c1[nH]c2c(c3ccccc13)Cc1cc(F)ccc1-2 |
| InChI | InChI=1S/C16H10FNO/c17-10-5-6-11-9(7-10)8-14-12-3-1-2-4-13(12)16(19)18-15(11)14/h1-7H,8H2,(H,18,19) |
| InChIKey | YZRNXEMHDKXRRA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |