About N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide
N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide (PubChem CID 25191023) has the molecular formula C22H21Cl2N3O
and a molecular weight of 414.34 g/mol. Its IUPAC name is N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide |
| PubChem CID | 25191023 |
| Molecular Formula | C22H21Cl2N3O |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1cc(Nc2ccc(Cl)c(Cl)c2)nc2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C22H21Cl2N3O/c23-17-11-10-15(12-18(17)24)25-21-13-20(16-8-4-5-9-19(16)26-21)27-22(28)14-6-2-1-3-7-14/h4-5,8-14H,1-3,6-7H2,(H2,25,26,27,28) |
| InChIKey | UWEIQVQNNLVOEI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide?
The IUPAC name of N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide (CID 25191023) is N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide.
What is the SMILES notation for N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide?
The canonical SMILES for N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide is O=C(Nc1cc(Nc2ccc(Cl)c(Cl)c2)nc2ccccc12)C1CCCCC1.
What is the InChIKey of N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide?
The InChIKey is UWEIQVQNNLVOEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21Cl2N3O/c23-17-11-10-15(12-18(17)24)25-21-13-20(16-8-4-5-9-19(16)26-21)27-22(28)14-6-2-1-3-7-14/h4-5,8-14H,1-3,6-7H2,(H2,25,26,27,28).
What are the key properties of N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide?
N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide has a molecular weight of 414.34 g/mol, XLogP of 6.80, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide is sourced from PubChem (CID 25191023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).