C30H15N5O5 — CID 25191093
5,10,19,24,29-pentazaundecacyclo[21.10.2.02,15.03,8.04,32.09,14.013,18.016,34.017,22.027,35.028,33]pentatriaconta-1,3,8,13,15,17,22,27,32,34-decaene-6,11,20,25,30-pentone (PubChem CID 25191093) has the molecular formula C30H15N5O5 and a molecular weight of 525.48 g/mol. Its IUPAC name is 5,10,19,24,29-pentazaundecacyclo[21.10.2.02,15.03,8.04,32.09,14.013,18.016,34.017,22.027,35.028,33]pentatriaconta-1,3,8,13,15,17,22,27,32,34-decaene-6,11,20,25,30-pentone.
| Compound Name | 5,10,19,24,29-pentazaundecacyclo[21.10.2.02,15.03,8.04,32.09,14.013,18.016,34.017,22.027,35.028,33]pentatriaconta-1,3,8,13,15,17,22,27,32,34-decaene-6,11,20,25,30-pentone |
|---|---|
| PubChem CID | 25191093 |
| Molecular Formula | C30H15N5O5 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 5,10,19,24,29-pentazaundecacyclo[21.10.2.02,15.03,8.04,32.09,14.013,18.016,34.017,22.027,35.028,33]pentatriaconta-1,3,8,13,15,17,22,27,32,34-decaene-6,11,20,25,30-pentone |
| SMILES | O=C1Cc2c3c4c(c5c6c(c7c8c(c9c%10c(c(c2c2c4c6c8c%102)N1)CC(=O)N9)CC(=O)N7)CC(=O)N5)CC(=O)N3 |
| InChI | InChI=1S/C30H15N5O5/c36-11-1-6-16-21-22-17-7(2-12(37)32-26(6)17)28-19-9(4-14(39)33-28)30-20-10(5-15(40)35-30)29-18(23(21)25(20)24(19)22)8(27(16)31-11)3-13(38)34-29/h1-5H2,(H,31,36)(H,32,37)(H,33,39)(H,34,38)(H,35,40) |
| InChIKey | SVPZJAPITCWKSX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|