C35H25N5O5 — CID 25191220
3,10,17,24,31-pentazaundecacyclo[27.6.5.02,7.08,37.09,14.015,38.016,21.022,39.023,28.030,35.036,40]tetraconta-1,7,9(14),15(38),16(21),22,28,30(35),36,39-decaene-4,11,18,25,32-pentone (PubChem CID 25191220) has the molecular formula C35H25N5O5 and a molecular weight of 595.62 g/mol. Its IUPAC name is 3,10,17,24,31-pentazaundecacyclo[27.6.5.02,7.08,37.09,14.015,38.016,21.022,39.023,28.030,35.036,40]tetraconta-1,7,9(14),15(38),16(21),22,28,30(35),36,39-decaene-4,11,18,25,32-pentone.
| Compound Name | 3,10,17,24,31-pentazaundecacyclo[27.6.5.02,7.08,37.09,14.015,38.016,21.022,39.023,28.030,35.036,40]tetraconta-1,7,9(14),15(38),16(21),22,28,30(35),36,39-decaene-4,11,18,25,32-pentone |
|---|---|
| PubChem CID | 25191220 |
| Molecular Formula | C35H25N5O5 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | 3,10,17,24,31-pentazaundecacyclo[27.6.5.02,7.08,37.09,14.015,38.016,21.022,39.023,28.030,35.036,40]tetraconta-1,7,9(14),15(38),16(21),22,28,30(35),36,39-decaene-4,11,18,25,32-pentone |
| SMILES | O=C1CCc2c(c3c4c(c5c6c(c7c8c(c9c%10c(c2c2c3c5c7c92)NC(=O)CC%10)NC(=O)CC8)NC(=O)CC6)NC(=O)CC4)N1 |
| InChI | InChI=1S/C35H25N5O5/c41-16-6-1-11-21-26-27-22(31(11)36-16)12-2-7-18(43)38-33(12)24-14-4-9-20(45)40-35(14)25-15-5-10-19(44)39-34(15)23(28(26)30(25)29(24)27)13-3-8-17(42)37-32(13)21/h1-10H2,(H,36,41)(H,37,42)(H,38,43)(H,39,44)(H,40,45) |
| InChIKey | JPEVGQDQPQVBMV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|