C28H32NO5P — CID 25192527
methyl (2S,3R)-1-diethoxyphosphoryl-5-methylidene-3-naphthalen-2-yl-2-phenylpiperidine-3-carboxylate (PubChem CID 25192527) has the molecular formula C28H32NO5P and a molecular weight of 493.54 g/mol. Its IUPAC name is methyl (2S,3R)-1-diethoxyphosphoryl-5-methylidene-3-naphthalen-2-yl-2-phenylpiperidine-3-carboxylate.
| Compound Name | methyl (2S,3R)-1-diethoxyphosphoryl-5-methylidene-3-naphthalen-2-yl-2-phenylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 25192527 |
| Molecular Formula | C28H32NO5P |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | methyl (2S,3R)-1-diethoxyphosphoryl-5-methylidene-3-naphthalen-2-yl-2-phenylpiperidine-3-carboxylate |
| SMILES | C=C1CN(P(=O)(OCC)OCC)[C@@H](c2ccccc2)[C@](C(=O)OC)(c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C28H32NO5P/c1-5-33-35(31,34-6-2)29-20-21(3)19-28(27(30)32-4,26(29)23-13-8-7-9-14-23)25-17-16-22-12-10-11-15-24(22)18-25/h7-18,26H,3,5-6,19-20H2,1-2,4H3/t26-,28+/m0/s1 |
| InChIKey | DFKKEAQDNXTZJT-XTEPFMGCSA-N |
| XLogP | 6.43 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|