C25H32NO5P — CID 102280489
methyl (2S,3S)-3-benzyl-1-diethoxyphosphoryl-5-methylidene-2-phenylpiperidine-3-carboxylate (PubChem CID 102280489) has the molecular formula C25H32NO5P and a molecular weight of 457.51 g/mol. Its IUPAC name is methyl (2S,3S)-3-benzyl-1-diethoxyphosphoryl-5-methylidene-2-phenylpiperidine-3-carboxylate.
| Compound Name | methyl (2S,3S)-3-benzyl-1-diethoxyphosphoryl-5-methylidene-2-phenylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 102280489 |
| Molecular Formula | C25H32NO5P |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | methyl (2S,3S)-3-benzyl-1-diethoxyphosphoryl-5-methylidene-2-phenylpiperidine-3-carboxylate |
| SMILES | C=C1CN(P(=O)(OCC)OCC)[C@@H](c2ccccc2)[C@@](Cc2ccccc2)(C(=O)OC)C1 |
| InChI | InChI=1S/C25H32NO5P/c1-5-30-32(28,31-6-2)26-19-20(3)17-25(24(27)29-4,18-21-13-9-7-10-14-21)23(26)22-15-11-8-12-16-22/h7-16,23H,3,5-6,17-19H2,1-2,4H3/t23-,25+/m0/s1 |
| InChIKey | ZURHRHGCQITSON-UKILVPOCSA-N |
| XLogP | 5.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|