C22H18F3NO5 — CID 25193426
ethyl (Z)-4-hydroxy-4-[4-methoxy-1-[(2,3,6-trifluorophenyl)methyl]indol-3-yl]-2-oxobut-3-enoate (PubChem CID 25193426) has the molecular formula C22H18F3NO5 and a molecular weight of 433.38 g/mol. Its IUPAC name is ethyl (Z)-4-hydroxy-4-[4-methoxy-1-[(2,3,6-trifluorophenyl)methyl]indol-3-yl]-2-oxobut-3-enoate.
| Compound Name | ethyl (Z)-4-hydroxy-4-[4-methoxy-1-[(2,3,6-trifluorophenyl)methyl]indol-3-yl]-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 25193426 |
| Molecular Formula | C22H18F3NO5 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | ethyl (Z)-4-hydroxy-4-[4-methoxy-1-[(2,3,6-trifluorophenyl)methyl]indol-3-yl]-2-oxobut-3-enoate |
| SMILES | CCOC(=O)C(=O)/C=C(\O)c1cn(Cc2c(F)ccc(F)c2F)c2cccc(OC)c12 |
| InChI | InChI=1S/C22H18F3NO5/c1-3-31-22(29)18(28)9-17(27)13-11-26(16-5-4-6-19(30-2)20(13)16)10-12-14(23)7-8-15(24)21(12)25/h4-9,11,27H,3,10H2,1-2H3/b17-9- |
| InChIKey | YZTDVNQDARVJPY-MFOYZWKCSA-N |
| XLogP | 4.15 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|