C22H19F2NO5 — CID 25194787
ethyl (Z)-4-[1-[(2,4-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate (PubChem CID 25194787) has the molecular formula C22H19F2NO5 and a molecular weight of 415.39 g/mol. Its IUPAC name is ethyl (Z)-4-[1-[(2,4-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate.
| Compound Name | ethyl (Z)-4-[1-[(2,4-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 25194787 |
| Molecular Formula | C22H19F2NO5 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | ethyl (Z)-4-[1-[(2,4-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoate |
| SMILES | CCOC(=O)C(=O)/C=C(\O)c1cn(Cc2ccc(F)cc2F)c2cccc(OC)c12 |
| InChI | InChI=1S/C22H19F2NO5/c1-3-30-22(28)19(27)10-18(26)15-12-25(11-13-7-8-14(23)9-16(13)24)17-5-4-6-20(29-2)21(15)17/h4-10,12,26H,3,11H2,1-2H3/b18-10- |
| InChIKey | IWROIKRQLGIUQA-ZDLGFXPLSA-N |
| XLogP | 4.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|