C28H38N4O12P2S — CID 25195047
[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] 8-(naphthalen-1-ylcarbamothioylamino)octyl hydrogen phosphate (PubChem CID 25195047) has the molecular formula C28H38N4O12P2S and a molecular weight of 716.64 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] 8-(naphthalen-1-ylcarbamothioylamino)octyl hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] 8-(naphthalen-1-ylcarbamothioylamino)octyl hydrogen phosphate |
|---|---|
| PubChem CID | 25195047 |
| Molecular Formula | C28H38N4O12P2S |
| Molecular Weight | 716.64 g/mol |
| Exact Mass | 716.17 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] 8-(naphthalen-1-ylcarbamothioylamino)octyl hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OCCCCCCCCNC(=S)Nc3cccc4ccccc34)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C28H38N4O12P2S/c33-23-14-16-32(28(36)31-23)26-25(35)24(34)22(43-26)18-42-46(39,40)44-45(37,38)41-17-8-4-2-1-3-7-15-29-27(47)30-21-13-9-11-19-10-5-6-12-20(19)21/h5-6,9-14,16,22,24-26,34-35H,1-4,7-8,15,17-18H2,(H,37,38)(H,39,40)(H2,29,30,47)(H,31,33,36)/t22-,24-,25-,26-/m1/s1 |
| InChIKey | KJUAORWAYGZCOF-VNSJUHMKSA-N |
| XLogP | 2.89 |
| TPSA | 230.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|