C15H12FN3O — CID 25195487
5-(cyclopropylamino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one (PubChem CID 25195487) has the molecular formula C15H12FN3O and a molecular weight of 269.28 g/mol. Its IUPAC name is 5-(cyclopropylamino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one.
| Compound Name | 5-(cyclopropylamino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25195487 |
| Molecular Formula | C15H12FN3O |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 5-(cyclopropylamino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2c(NC3CC3)nc3ccc(F)cc3c12 |
| InChI | InChI=1S/C15H12FN3O/c16-8-1-4-12-11(7-8)13-10(5-6-17-15(13)20)14(19-12)18-9-2-3-9/h1,4-7,9H,2-3H2,(H,17,20)(H,18,19) |
| InChIKey | JVUPCNIPPMTQKN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|