C20H24F3N6O13P3 — CID 25197217
[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methoxy]phosphoryl] hydrogen phosphate (PubChem CID 25197217) has the molecular formula C20H24F3N6O13P3 and a molecular weight of 706.36 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methoxy]phosphoryl] hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methoxy]phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 25197217 |
| Molecular Formula | C20H24F3N6O13P3 |
| Molecular Weight | 706.36 g/mol |
| Exact Mass | 706.06 |
| IUPAC Name | [[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methoxy]phosphoryl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OCc2ccc(CNC(=O)C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C20H24F3N6O13P3/c21-20(22,23)19(31)25-6-11-1-3-12(4-2-11)7-38-43(32,33)41-45(36,37)42-44(34,35)39-8-14-13(30)5-15(40-14)29-10-28-16-17(24)26-9-27-18(16)29/h1-4,9-10,13-15,30H,5-8H2,(H,25,31)(H,32,33)(H,34,35)(H,36,37)(H2,24,26,27)/t13-,14+,15+/m0/s1 |
| InChIKey | PUBIPLXQNXLLMA-RRFJBIMHSA-N |
| XLogP | 1.80 |
| TPSA | 277.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|