C11H20N2O3S — CID 25197704
methyl (2S)-2-[acetyl-(2-amino-2-sulfanylideneethyl)amino]-4-methylpentanoate (PubChem CID 25197704) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is methyl (2S)-2-[acetyl-(2-amino-2-sulfanylideneethyl)amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[acetyl-(2-amino-2-sulfanylideneethyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 25197704 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | methyl (2S)-2-[acetyl-(2-amino-2-sulfanylideneethyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)N(CC(N)=S)C(C)=O |
| InChI | InChI=1S/C11H20N2O3S/c1-7(2)5-9(11(15)16-4)13(8(3)14)6-10(12)17/h7,9H,5-6H2,1-4H3,(H2,12,17)/t9-/m0/s1 |
| InChIKey | UABWXVSSFWAUAB-VIFPVBQESA-N |
| XLogP | 0.71 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|